C20H29NO2S — CID 11371454
(4aS,5R,8aR)-5-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 11371454) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is (4aS,5R,8aR)-5-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aS,5R,8aR)-5-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 11371454 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (4aS,5R,8aR)-5-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | C/C=C/C1CC[C@H]2[C@H](C)CCC[C@H]2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H29NO2S/c1-4-6-17-11-14-19-16(3)7-5-8-20(19)21(17)24(22,23)18-12-9-15(2)10-13-18/h4,6,9-10,12-13,16-17,19-20H,5,7-8,11,14H2,1-3H3/b6-4+/t16-,17?,19+,20-/m1/s1 |
| InChIKey | SDRSUABGGXHSPO-KRLRYNQTSA-N |
| XLogP | 4.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|