C13H15NO3S — CID 154708498
(4R)-1-(4-methylphenyl)sulfonyl-4-[(Z)-prop-1-enyl]azetidin-2-one (PubChem CID 154708498) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is (4R)-1-(4-methylphenyl)sulfonyl-4-[(Z)-prop-1-enyl]azetidin-2-one.
| Compound Name | (4R)-1-(4-methylphenyl)sulfonyl-4-[(Z)-prop-1-enyl]azetidin-2-one |
|---|---|
| PubChem CID | 154708498 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (4R)-1-(4-methylphenyl)sulfonyl-4-[(Z)-prop-1-enyl]azetidin-2-one |
| SMILES | C/C=C\[C@H]1CC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15NO3S/c1-3-4-11-9-13(15)14(11)18(16,17)12-7-5-10(2)6-8-12/h3-8,11H,9H2,1-2H3/b4-3-/t11-/m0/s1 |
| InChIKey | LEGSRFWIJIGNGK-BYCRGOAPSA-N |
| XLogP | 1.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|