C11H12BrNO3S — CID 86016527
4-(bromomethyl)-1-(4-methylphenyl)sulfonylazetidin-2-one (PubChem CID 86016527) has the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(4-methylphenyl)sulfonylazetidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(4-methylphenyl)sulfonylazetidin-2-one |
|---|---|
| PubChem CID | 86016527 |
| Molecular Formula | C11H12BrNO3S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 4-(bromomethyl)-1-(4-methylphenyl)sulfonylazetidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC2CBr)cc1 |
| InChI | InChI=1S/C11H12BrNO3S/c1-8-2-4-10(5-3-8)17(15,16)13-9(7-12)6-11(13)14/h2-5,9H,6-7H2,1H3 |
| InChIKey | XLIMTHGONRLRBI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|