C12H12BrF2NO3S — CID 10832806
4-(bromomethyl)-3,3-difluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 10832806) has the molecular formula C12H12BrF2NO3S and a molecular weight of 368.20 g/mol. Its IUPAC name is 4-(bromomethyl)-3,3-difluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-3,3-difluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10832806 |
| Molecular Formula | C12H12BrF2NO3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 4-(bromomethyl)-3,3-difluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(CBr)C(F)(F)C2=O)cc1 |
| InChI | InChI=1S/C12H12BrF2NO3S/c1-8-2-4-10(5-3-8)20(18,19)16-7-9(6-13)12(14,15)11(16)17/h2-5,9H,6-7H2,1H3 |
| InChIKey | CNBTXFHGEOBQHV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|