C10H10F3NO2S — CID 11448470
(2R)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine (PubChem CID 11448470) has the molecular formula C10H10F3NO2S and a molecular weight of 265.26 g/mol. Its IUPAC name is (2R)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine.
| Compound Name | (2R)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine |
|---|---|
| PubChem CID | 11448470 |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | (2R)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]2C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO2S/c1-7-2-4-8(5-3-7)17(15,16)14-6-9(14)10(11,12)13/h2-5,9H,6H2,1H3/t9-,14?/m1/s1 |
| InChIKey | OCDVSJGBBHWGPE-UCWRFOARSA-N |
| XLogP | 1.93 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|