C11H12F3NO3S — CID 169410124
[2-(trifluoromethyl)azetidin-1-yl] 4-methylbenzenesulfonate (PubChem CID 169410124) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is [2-(trifluoromethyl)azetidin-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-(trifluoromethyl)azetidin-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169410124 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | [2-(trifluoromethyl)azetidin-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2CCC2C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO3S/c1-8-2-4-9(5-3-8)19(16,17)18-15-7-6-10(15)11(12,13)14/h2-5,10H,6-7H2,1H3 |
| InChIKey | GQLFWTHOILWVRG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |