C15H19F4NO3S — CID 167468275
[3-(4,4-difluoropiperidin-1-yl)-2,2-difluoropropyl] 4-methylbenzenesulfonate (PubChem CID 167468275) has the molecular formula C15H19F4NO3S and a molecular weight of 369.38 g/mol. Its IUPAC name is [3-(4,4-difluoropiperidin-1-yl)-2,2-difluoropropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(4,4-difluoropiperidin-1-yl)-2,2-difluoropropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167468275 |
| Molecular Formula | C15H19F4NO3S |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [3-(4,4-difluoropiperidin-1-yl)-2,2-difluoropropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)CN2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C15H19F4NO3S/c1-12-2-4-13(5-3-12)24(21,22)23-11-15(18,19)10-20-8-6-14(16,17)7-9-20/h2-5H,6-11H2,1H3 |
| InChIKey | QDUCCURPOIBZTI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|