C12H15F3O4S — CID 89453267
2-(1,1,1-trifluoropropan-2-yloxy)ethyl 4-methylbenzenesulfonate (PubChem CID 89453267) has the molecular formula C12H15F3O4S and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-(1,1,1-trifluoropropan-2-yloxy)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(1,1,1-trifluoropropan-2-yloxy)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89453267 |
| Molecular Formula | C12H15F3O4S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(1,1,1-trifluoropropan-2-yloxy)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O4S/c1-9-3-5-11(6-4-9)20(16,17)19-8-7-18-10(2)12(13,14)15/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | QAFWFLOVQOPEHO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|