About 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate
3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate (PubChem CID 19102388) has the molecular formula C17H25F3O3S
and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate |
| PubChem CID | 19102388 |
| Molecular Formula | C17H25F3O3S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate |
| SMILES | CCCCCCC(CCOS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H25F3O3S/c1-3-4-5-6-7-15(17(18,19)20)12-13-23-24(21,22)16-10-8-14(2)9-11-16/h8-11,15H,3-7,12-13H2,1-2H3 |
| InChIKey | WHHRUQRHMGXPJS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate?
The IUPAC name of 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate (CID 19102388) is 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate.
What is the SMILES notation for 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate?
The canonical SMILES for 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate is CCCCCCC(CCOS(=O)(=O)c1ccc(C)cc1)C(F)(F)F.
What is the InChIKey of 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate?
The InChIKey is WHHRUQRHMGXPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F3O3S/c1-3-4-5-6-7-15(17(18,19)20)12-13-23-24(21,22)16-10-8-14(2)9-11-16/h8-11,15H,3-7,12-13H2,1-2H3.
What are the key properties of 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate?
3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate has a molecular weight of 366.45 g/mol, XLogP of 5.24, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)nonyl 4-methylbenzenesulfonate is sourced from PubChem (CID 19102388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).