C34H57ClO8S2 — CID 160912579
(3R)-decane-1,3-diol;[(3R)-3-hydroxydecyl] 4-methylbenzenesulfonate;4-methylbenzenesulfonyl chloride (PubChem CID 160912579) has the molecular formula C34H57ClO8S2 and a molecular weight of 693.41 g/mol. Its IUPAC name is (3R)-decane-1,3-diol;[(3R)-3-hydroxydecyl] 4-methylbenzenesulfonate;4-methylbenzenesulfonyl chloride.
| Compound Name | (3R)-decane-1,3-diol;[(3R)-3-hydroxydecyl] 4-methylbenzenesulfonate;4-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 160912579 |
| Molecular Formula | C34H57ClO8S2 |
| Molecular Weight | 693.41 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | (3R)-decane-1,3-diol;[(3R)-3-hydroxydecyl] 4-methylbenzenesulfonate;4-methylbenzenesulfonyl chloride |
| SMILES | CCCCCCC[C@@H](O)CCO.CCCCCCC[C@@H](O)CCOS(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C17H28O4S.C10H22O2.C7H7ClO2S/c1-3-4-5-6-7-8-16(18)13-14-21-22(19,20)17-11-9-15(2)10-12-17;1-2-3-4-5-6-7-10(12)8-9-11;1-6-2-4-7(5-3-6)11(8,9)10/h9-12,16,18H,3-8,13-14H2,1-2H3;10-12H,2-9H2,1H3;2-5H,1H3/t16-;10-;/m11./s1 |
| InChIKey | SQZFKCJLCQLIOZ-OLNPDCBSSA-N |
| XLogP | 7.82 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.41 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|