C18H28F2O3S — CID 132990181
[(10S)-10,11-difluoroundecyl] 4-methylbenzenesulfonate (PubChem CID 132990181) has the molecular formula C18H28F2O3S and a molecular weight of 362.48 g/mol. Its IUPAC name is [(10S)-10,11-difluoroundecyl] 4-methylbenzenesulfonate.
| Compound Name | [(10S)-10,11-difluoroundecyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 132990181 |
| Molecular Formula | C18H28F2O3S |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(10S)-10,11-difluoroundecyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCCC[C@H](F)CF)cc1 |
| InChI | InChI=1S/C18H28F2O3S/c1-16-10-12-18(13-11-16)24(21,22)23-14-8-6-4-2-3-5-7-9-17(20)15-19/h10-13,17H,2-9,14-15H2,1H3/t17-/m0/s1 |
| InChIKey | PEFVAUFXLYJAGX-KRWDZBQOSA-N |
| XLogP | 5.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|