C24H25F2NO7S — CID 86682393
diethyl 1-[2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropyl]indole-2,6-dicarboxylate (PubChem CID 86682393) has the molecular formula C24H25F2NO7S and a molecular weight of 509.53 g/mol. Its IUPAC name is diethyl 1-[2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropyl]indole-2,6-dicarboxylate.
| Compound Name | diethyl 1-[2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropyl]indole-2,6-dicarboxylate |
|---|---|
| PubChem CID | 86682393 |
| Molecular Formula | C24H25F2NO7S |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | diethyl 1-[2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropyl]indole-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2cc(C(=O)OCC)n(CC(F)(F)COS(=O)(=O)c3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C24H25F2NO7S/c1-4-32-22(28)18-9-8-17-12-21(23(29)33-5-2)27(20(17)13-18)14-24(25,26)15-34-35(30,31)19-10-6-16(3)7-11-19/h6-13H,4-5,14-15H2,1-3H3 |
| InChIKey | VJXMVXXXDSHGAS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|