C17H21NO6 — CID 58767575
diethyl 1-[(2R)-2,3-dihydroxypropyl]indole-2,6-dicarboxylate (PubChem CID 58767575) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is diethyl 1-[(2R)-2,3-dihydroxypropyl]indole-2,6-dicarboxylate.
| Compound Name | diethyl 1-[(2R)-2,3-dihydroxypropyl]indole-2,6-dicarboxylate |
|---|---|
| PubChem CID | 58767575 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | diethyl 1-[(2R)-2,3-dihydroxypropyl]indole-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2cc(C(=O)OCC)n(C[C@@H](O)CO)c2c1 |
| InChI | InChI=1S/C17H21NO6/c1-3-23-16(21)12-6-5-11-7-15(17(22)24-4-2)18(14(11)8-12)9-13(20)10-19/h5-8,13,19-20H,3-4,9-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | HOCJWTWORYEANN-CYBMUJFWSA-N |
| XLogP | 1.35 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |