About ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate
ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate (PubChem CID 105421719) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate |
| PubChem CID | 105421719 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)ccn1CC(O)CO |
| InChI | InChI=1S/C11H17NO4/c1-3-16-11(15)10-8(2)4-5-12(10)6-9(14)7-13/h4-5,9,13-14H,3,6-7H2,1-2H3 |
| InChIKey | YBBHNRFQTPZUAO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate?
The IUPAC name of ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate (CID 105421719) is ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate.
What is the SMILES notation for ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate?
The canonical SMILES for ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate is CCOC(=O)c1c(C)ccn1CC(O)CO.
What is the InChIKey of ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate?
The InChIKey is YBBHNRFQTPZUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-3-16-11(15)10-8(2)4-5-12(10)6-9(14)7-13/h4-5,9,13-14H,3,6-7H2,1-2H3.
What are the key properties of ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate?
ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate has a molecular weight of 227.26 g/mol, XLogP of 0.33, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,3-dihydroxypropyl)-3-methylpyrrole-2-carboxylate is sourced from PubChem (CID 105421719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).