C13H20N2O5 — CID 71030988
3-butoxy-1-(2,3-dihydroxypropyl)-4-oxopyridine-2-carboxamide (PubChem CID 71030988) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-butoxy-1-(2,3-dihydroxypropyl)-4-oxopyridine-2-carboxamide.
| Compound Name | 3-butoxy-1-(2,3-dihydroxypropyl)-4-oxopyridine-2-carboxamide |
|---|---|
| PubChem CID | 71030988 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-butoxy-1-(2,3-dihydroxypropyl)-4-oxopyridine-2-carboxamide |
| SMILES | CCCCOc1c(C(N)=O)n(CC(O)CO)ccc1=O |
| InChI | InChI=1S/C13H20N2O5/c1-2-3-6-20-12-10(18)4-5-15(7-9(17)8-16)11(12)13(14)19/h4-5,9,16-17H,2-3,6-8H2,1H3,(H2,14,19) |
| InChIKey | RRQFDFPYZSGKPV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|