C12H17NO6 — CID 129018248
methyl 1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate (PubChem CID 129018248) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is methyl 1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate.
| Compound Name | methyl 1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate |
|---|---|
| PubChem CID | 129018248 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | methyl 1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate |
| SMILES | COC(=O)c1c(OC)c(=O)ccn1CC(OC)OC |
| InChI | InChI=1S/C12H17NO6/c1-16-9(17-2)7-13-6-5-8(14)11(18-3)10(13)12(15)19-4/h5-6,9H,7H2,1-4H3 |
| InChIKey | WXUOIBAKTNPRHI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|