C9H12ClNO3 — CID 134285297
methyl 3-chloro-1-(3-hydroxypropyl)pyrrole-2-carboxylate (PubChem CID 134285297) has the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. Its IUPAC name is methyl 3-chloro-1-(3-hydroxypropyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-chloro-1-(3-hydroxypropyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134285297 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | methyl 3-chloro-1-(3-hydroxypropyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(Cl)ccn1CCCO |
| InChI | InChI=1S/C9H12ClNO3/c1-14-9(13)8-7(10)3-5-11(8)4-2-6-12/h3,5,12H,2,4,6H2,1H3 |
| InChIKey | IEQNBNQNCJDDKF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |