C13H13Cl2NO3 — CID 83947544
methyl 6,7-dichloro-1-(3-hydroxypropyl)indole-3-carboxylate (PubChem CID 83947544) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is methyl 6,7-dichloro-1-(3-hydroxypropyl)indole-3-carboxylate.
| Compound Name | methyl 6,7-dichloro-1-(3-hydroxypropyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 83947544 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | methyl 6,7-dichloro-1-(3-hydroxypropyl)indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CCCO)c2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C13H13Cl2NO3/c1-19-13(18)9-7-16(5-2-6-17)12-8(9)3-4-10(14)11(12)15/h3-4,7,17H,2,5-6H2,1H3 |
| InChIKey | GJFOODQWGDVXQJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |