C13H17NO8 — CID 53469000
1-(2,2-dimethoxyethyl)-5-methoxy-6-methoxycarbonyl-4-oxopyridine-3-carboxylic acid (PubChem CID 53469000) has the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-methoxy-6-methoxycarbonyl-4-oxopyridine-3-carboxylic acid.
| Compound Name | 1-(2,2-dimethoxyethyl)-5-methoxy-6-methoxycarbonyl-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53469000 |
| Molecular Formula | C13H17NO8 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-methoxy-6-methoxycarbonyl-4-oxopyridine-3-carboxylic acid |
| SMILES | COC(=O)c1c(OC)c(=O)c(C(=O)O)cn1CC(OC)OC |
| InChI | InChI=1S/C13H17NO8/c1-19-8(20-2)6-14-5-7(12(16)17)10(15)11(21-3)9(14)13(18)22-4/h5,8H,6H2,1-4H3,(H,16,17) |
| InChIKey | XAXGEECGULRZGN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|