C17H16F2N2O7 — CID 175453243
methyl 5-[(2,4-difluorophenyl)carbamoyl]-1-(2,2-dihydroxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate (PubChem CID 175453243) has the molecular formula C17H16F2N2O7 and a molecular weight of 398.32 g/mol. Its IUPAC name is methyl 5-[(2,4-difluorophenyl)carbamoyl]-1-(2,2-dihydroxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate.
| Compound Name | methyl 5-[(2,4-difluorophenyl)carbamoyl]-1-(2,2-dihydroxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate |
|---|---|
| PubChem CID | 175453243 |
| Molecular Formula | C17H16F2N2O7 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | methyl 5-[(2,4-difluorophenyl)carbamoyl]-1-(2,2-dihydroxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate |
| SMILES | COC(=O)c1c(OC)c(=O)c(C(=O)Nc2ccc(F)cc2F)cn1CC(O)O |
| InChI | InChI=1S/C17H16F2N2O7/c1-27-15-13(17(26)28-2)21(7-12(22)23)6-9(14(15)24)16(25)20-11-4-3-8(18)5-10(11)19/h3-6,12,22-23H,7H2,1-2H3,(H,20,25) |
| InChIKey | NINRXGXGYUZQJH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|