C23H28F2N2O7 — CID 118264945
ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-1-(2,2-dihydroxyethyl)-3-(3-methylbutoxy)-4-oxopyridine-2-carboxylate (PubChem CID 118264945) has the molecular formula C23H28F2N2O7 and a molecular weight of 482.48 g/mol. Its IUPAC name is ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-1-(2,2-dihydroxyethyl)-3-(3-methylbutoxy)-4-oxopyridine-2-carboxylate.
| Compound Name | ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-1-(2,2-dihydroxyethyl)-3-(3-methylbutoxy)-4-oxopyridine-2-carboxylate |
|---|---|
| PubChem CID | 118264945 |
| Molecular Formula | C23H28F2N2O7 |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-1-(2,2-dihydroxyethyl)-3-(3-methylbutoxy)-4-oxopyridine-2-carboxylate |
| SMILES | CCOC(=O)c1c(OCCC(C)C)c(=O)c(C(=O)NCc2ccc(F)cc2F)cn1CC(O)O |
| InChI | InChI=1S/C23H28F2N2O7/c1-4-33-23(32)19-21(34-8-7-13(2)3)20(30)16(11-27(19)12-18(28)29)22(31)26-10-14-5-6-15(24)9-17(14)25/h5-6,9,11,13,18,28-29H,4,7-8,10,12H2,1-3H3,(H,26,31) |
| InChIKey | ORKPJMIVIJGDSX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|