C20H21F2NO6 — CID 90323058
ethyl 3-butoxy-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxopyran-2-carboxylate (PubChem CID 90323058) has the molecular formula C20H21F2NO6 and a molecular weight of 409.39 g/mol. Its IUPAC name is ethyl 3-butoxy-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxopyran-2-carboxylate.
| Compound Name | ethyl 3-butoxy-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxopyran-2-carboxylate |
|---|---|
| PubChem CID | 90323058 |
| Molecular Formula | C20H21F2NO6 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | ethyl 3-butoxy-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxopyran-2-carboxylate |
| SMILES | CCCCOc1c(C(=O)OCC)occ(C(=O)NCc2ccc(F)cc2F)c1=O |
| InChI | InChI=1S/C20H21F2NO6/c1-3-5-8-28-17-16(24)14(11-29-18(17)20(26)27-4-2)19(25)23-10-12-6-7-13(21)9-15(12)22/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,23,25) |
| InChIKey | DDEBUURJNSCIQC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|