C28H27F2N3O4 — CID 155622814
15-butoxy-N-[(2,4-difluorophenyl)methyl]-14,17-dioxo-1,11-diazatetracyclo[8.7.1.02,7.011,16]octadeca-2,4,6,12,15-pentaene-13-carboxamide (PubChem CID 155622814) has the molecular formula C28H27F2N3O4 and a molecular weight of 507.54 g/mol. Its IUPAC name is 15-butoxy-N-[(2,4-difluorophenyl)methyl]-14,17-dioxo-1,11-diazatetracyclo[8.7.1.02,7.011,16]octadeca-2,4,6,12,15-pentaene-13-carboxamide.
| Compound Name | 15-butoxy-N-[(2,4-difluorophenyl)methyl]-14,17-dioxo-1,11-diazatetracyclo[8.7.1.02,7.011,16]octadeca-2,4,6,12,15-pentaene-13-carboxamide |
|---|---|
| PubChem CID | 155622814 |
| Molecular Formula | C28H27F2N3O4 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 15-butoxy-N-[(2,4-difluorophenyl)methyl]-14,17-dioxo-1,11-diazatetracyclo[8.7.1.02,7.011,16]octadeca-2,4,6,12,15-pentaene-13-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)C1CCc3ccccc3N(C1)C2=O |
| InChI | InChI=1S/C28H27F2N3O4/c1-2-3-12-37-26-24-28(36)33-15-20(11-9-17-6-4-5-7-23(17)33)32(24)16-21(25(26)34)27(35)31-14-18-8-10-19(29)13-22(18)30/h4-8,10,13,16,20H,2-3,9,11-12,14-15H2,1H3,(H,31,35) |
| InChIKey | XNAXUYNPXFYGMA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|