C25H28F2N4O4 — CID 169025908
(10R,13S)-6-butoxy-N-[(2,4-difluorophenyl)methyl]-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 169025908) has the molecular formula C25H28F2N4O4 and a molecular weight of 486.52 g/mol. Its IUPAC name is (10R,13S)-6-butoxy-N-[(2,4-difluorophenyl)methyl]-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (10R,13S)-6-butoxy-N-[(2,4-difluorophenyl)methyl]-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 169025908 |
| Molecular Formula | C25H28F2N4O4 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (10R,13S)-6-butoxy-N-[(2,4-difluorophenyl)methyl]-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)N1CN(C2=O)[C@H](C)C=C[C@@H]1C |
| InChI | InChI=1S/C25H28F2N4O4/c1-4-5-10-35-23-21-25(34)29-14-31(16(3)7-6-15(29)2)30(21)13-19(22(23)32)24(33)28-12-17-8-9-18(26)11-20(17)27/h6-9,11,13,15-16H,4-5,10,12,14H2,1-3H3,(H,28,33)/t15-,16+/m1/s1 |
| InChIKey | HZTKHDUXOJVPHJ-CVEARBPZSA-N |
| XLogP | 2.93 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|