C21H20F4N4O4 — CID 164928594
N-[(2,4-difluorophenyl)methyl]-11,11-difluoro-6-hydroxy-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 164928594) has the molecular formula C21H20F4N4O4 and a molecular weight of 468.41 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-11,11-difluoro-6-hydroxy-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-11,11-difluoro-6-hydroxy-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 164928594 |
| Molecular Formula | C21H20F4N4O4 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-11,11-difluoro-6-hydroxy-10,13-dimethyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | CC1CC(F)(F)C(C)N2CN1n1cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C21H20F4N4O4/c1-10-6-21(24,25)11(2)27-9-29(10)28-8-14(17(30)18(31)16(28)20(27)33)19(32)26-7-12-3-4-13(22)5-15(12)23/h3-5,8,10-11,31H,6-7,9H2,1-2H3,(H,26,32) |
| InChIKey | KUOCRYAVIGQWJV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |