C21H19F3N4O4 — CID 164590685
(10R,13R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 164590685) has the molecular formula C21H19F3N4O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is (10R,13R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (10R,13R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 164590685 |
| Molecular Formula | C21H19F3N4O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (10R,13R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methyl-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | C[C@@H]1C=C[C@H](CF)N2CN1n1cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C21H19F3N4O4/c1-11-2-5-14(7-22)26-10-28(11)27-9-15(18(29)19(30)17(27)21(26)32)20(31)25-8-12-3-4-13(23)6-16(12)24/h2-6,9,11,14,30H,7-8,10H2,1H3,(H,25,31)/t11-,14-/m1/s1 |
| InChIKey | RSYVQMONBSVQEV-BXUZGUMPSA-N |
| XLogP | 1.41 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|