C22H21F3N4O5 — CID 164590701
(10S,13S)-6-hydroxy-13-(methoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 164590701) has the molecular formula C22H21F3N4O5 and a molecular weight of 478.43 g/mol. Its IUPAC name is (10S,13S)-6-hydroxy-13-(methoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (10S,13S)-6-hydroxy-13-(methoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 164590701 |
| Molecular Formula | C22H21F3N4O5 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (10S,13S)-6-hydroxy-13-(methoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | COC[C@@H]1C=C[C@H](C)N2CN1n1cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C22H21F3N4O5/c1-11-3-4-13(9-34-2)29-10-27(11)22(33)18-20(31)19(30)15(8-28(18)29)21(32)26-7-14-16(24)5-12(23)6-17(14)25/h3-6,8,11,13,31H,7,9-10H2,1-2H3,(H,26,32)/t11-,13-/m0/s1 |
| InChIKey | HARLNFYKDDVWDP-AAEUAGOBSA-N |
| XLogP | 1.23 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|