C21H20F4N4O4 — CID 164590667
fluoromethane;6-hydroxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 164590667) has the molecular formula C21H20F4N4O4 and a molecular weight of 468.41 g/mol. Its IUPAC name is fluoromethane;6-hydroxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | fluoromethane;6-hydroxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 164590667 |
| Molecular Formula | C21H20F4N4O4 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | fluoromethane;6-hydroxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | CC1C=CCN2CN1C(=O)c1c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12.CF |
| InChI | InChI=1S/C20H17F3N4O4.CH3F/c1-10-3-2-4-25-9-26(10)20(31)16-18(29)17(28)13(8-27(16)25)19(30)24-7-12-14(22)5-11(21)6-15(12)23;1-2/h2-3,5-6,8,10,29H,4,7,9H2,1H3,(H,24,30);1H3 |
| InChIKey | CEZOXJBTMPPQSX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|