C21H16ClF3N4O4 — CID 164590542
(10S)-N-[(3-chloro-2,4,6-trifluorophenyl)methyl]-6-hydroxy-10-methyl-13-methylidene-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 164590542) has the molecular formula C21H16ClF3N4O4 and a molecular weight of 480.83 g/mol. Its IUPAC name is (10S)-N-[(3-chloro-2,4,6-trifluorophenyl)methyl]-6-hydroxy-10-methyl-13-methylidene-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (10S)-N-[(3-chloro-2,4,6-trifluorophenyl)methyl]-6-hydroxy-10-methyl-13-methylidene-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 164590542 |
| Molecular Formula | C21H16ClF3N4O4 |
| Molecular Weight | 480.83 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (10S)-N-[(3-chloro-2,4,6-trifluorophenyl)methyl]-6-hydroxy-10-methyl-13-methylidene-5,8-dioxo-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | C=C1C=C[C@H](C)N2CN1n1cc(C(=O)NCc3c(F)cc(F)c(Cl)c3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C21H16ClF3N4O4/c1-9-3-4-10(2)29-8-27(9)21(33)17-19(31)18(30)12(7-28(17)29)20(32)26-6-11-13(23)5-14(24)15(22)16(11)25/h3-5,7,9,31H,2,6,8H2,1H3,(H,26,32)/t9-/m0/s1 |
| InChIKey | JSMLKZPMCZBZEU-VIFPVBQESA-N |
| XLogP | 2.38 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.83 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|