C22H20F5N3O4 — CID 130333439
(10R,11R)-11-ethyl-12,13-difluoro-4-hydroxy-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide (PubChem CID 130333439) has the molecular formula C22H20F5N3O4 and a molecular weight of 485.41 g/mol. Its IUPAC name is (10R,11R)-11-ethyl-12,13-difluoro-4-hydroxy-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide.
| Compound Name | (10R,11R)-11-ethyl-12,13-difluoro-4-hydroxy-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 130333439 |
| Molecular Formula | C22H20F5N3O4 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (10R,11R)-11-ethyl-12,13-difluoro-4-hydroxy-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
| SMILES | CC[C@H]1C(F)C(F)CN2C(=O)c3c(O)c(=O)c(C(=O)NCc4c(F)cc(F)cc4F)cn3C[C@@H]12 |
| InChI | InChI=1S/C22H20F5N3O4/c1-2-10-16-8-29-6-12(21(33)28-5-11-13(24)3-9(23)4-14(11)25)19(31)20(32)18(29)22(34)30(16)7-15(26)17(10)27/h3-4,6,10,15-17,32H,2,5,7-8H2,1H3,(H,28,33)/t10-,15?,16+,17?/m1/s1 |
| InChIKey | FWFUXMYYRQFKEE-PJXZTAOXSA-N |
| XLogP | 2.44 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |