C25H28F3N3O4 — CID 130392325
(13S)-14-ethyl-4-hydroxy-11,12,13-trimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide (PubChem CID 130392325) has the molecular formula C25H28F3N3O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is (13S)-14-ethyl-4-hydroxy-11,12,13-trimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide.
| Compound Name | (13S)-14-ethyl-4-hydroxy-11,12,13-trimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 130392325 |
| Molecular Formula | C25H28F3N3O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | (13S)-14-ethyl-4-hydroxy-11,12,13-trimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
| SMILES | CCC1[C@@H](C)C(C)C(C)C2Cn3cc(C(=O)NCc4c(F)cc(F)cc4F)c(=O)c(O)c3C(=O)N21 |
| InChI | InChI=1S/C25H28F3N3O4/c1-5-19-12(3)11(2)13(4)20-10-30-9-16(22(32)23(33)21(30)25(35)31(19)20)24(34)29-8-15-17(27)6-14(26)7-18(15)28/h6-7,9,11-13,19-20,33H,5,8,10H2,1-4H3,(H,29,34)/t11?,12-,13?,19?,20?/m0/s1 |
| InChIKey | ROZQAVJKVUGFPN-VFMJZFBVSA-N |
| XLogP | 3.43 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |