C20H19F4N3O4 — CID 155699933
2-(2-fluorobutyl)-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 155699933) has the molecular formula C20H19F4N3O4 and a molecular weight of 441.38 g/mol. Its IUPAC name is 2-(2-fluorobutyl)-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 2-(2-fluorobutyl)-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 155699933 |
| Molecular Formula | C20H19F4N3O4 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-(2-fluorobutyl)-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | CCC(F)CN1CCn2cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C20H19F4N3O4/c1-2-10(21)8-27-4-3-26-9-13(17(28)18(29)16(26)20(27)31)19(30)25-7-12-14(23)5-11(22)6-15(12)24/h5-6,9-10,29H,2-4,7-8H2,1H3,(H,25,30) |
| InChIKey | YYNNSXUVZJLAAE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |