C19H19F3N4O4 — CID 170231161
2-(aminomethyl)-11-hydroxy-1,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4,5,6-tetrahydropyrido[1,2-a][1,4]diazocine-9-carboxamide (PubChem CID 170231161) has the molecular formula C19H19F3N4O4 and a molecular weight of 424.38 g/mol. Its IUPAC name is 2-(aminomethyl)-11-hydroxy-1,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4,5,6-tetrahydropyrido[1,2-a][1,4]diazocine-9-carboxamide.
| Compound Name | 2-(aminomethyl)-11-hydroxy-1,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4,5,6-tetrahydropyrido[1,2-a][1,4]diazocine-9-carboxamide |
|---|---|
| PubChem CID | 170231161 |
| Molecular Formula | C19H19F3N4O4 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-(aminomethyl)-11-hydroxy-1,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4,5,6-tetrahydropyrido[1,2-a][1,4]diazocine-9-carboxamide |
| SMILES | NCN1CCCCn2cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C19H19F3N4O4/c20-10-5-13(21)11(14(22)6-10)7-24-18(29)12-8-25-3-1-2-4-26(9-23)19(30)15(25)17(28)16(12)27/h5-6,8,28H,1-4,7,9,23H2,(H,24,29) |
| InChIKey | RWISPJCNUCRGQF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |