C21H19F4N3O4 — CID 155699857
2-[(E)-3-fluoropent-3-en-2-yl]-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 155699857) has the molecular formula C21H19F4N3O4 and a molecular weight of 453.39 g/mol. Its IUPAC name is 2-[(E)-3-fluoropent-3-en-2-yl]-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 2-[(E)-3-fluoropent-3-en-2-yl]-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 155699857 |
| Molecular Formula | C21H19F4N3O4 |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 2-[(E)-3-fluoropent-3-en-2-yl]-9-hydroxy-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | C/C=C(/F)C(C)N1CCn2cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C21H19F4N3O4/c1-3-14(23)10(2)28-5-4-27-9-13(18(29)19(30)17(27)21(28)32)20(31)26-8-12-15(24)6-11(22)7-16(12)25/h3,6-7,9-10,30H,4-5,8H2,1-2H3,(H,26,31)/b14-3+ |
| InChIKey | PMJMZPPUKHGAFD-LZWSPWQCSA-N |
| XLogP | 2.62 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |