C23H24F3N3O4 — CID 130391719
(10S,14R)-4-hydroxy-10,14-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide (PubChem CID 130391719) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is (10S,14R)-4-hydroxy-10,14-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide.
| Compound Name | (10S,14R)-4-hydroxy-10,14-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 130391719 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (10S,14R)-4-hydroxy-10,14-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide |
| SMILES | C[C@@H]1CCC[C@@]2(C)Cn3cc(C(=O)NCc4c(F)cc(F)cc4F)c(=O)c(O)c3C(=O)N2C1 |
| InChI | InChI=1S/C23H24F3N3O4/c1-12-4-3-5-23(2)11-28-10-15(19(30)20(31)18(28)22(33)29(23)9-12)21(32)27-8-14-16(25)6-13(24)7-17(14)26/h6-7,10,12,31H,3-5,8-9,11H2,1-2H3,(H,27,32)/t12-,23+/m1/s1 |
| InChIKey | SSYNWWONUKXWQP-SPSFWMDKSA-N |
| XLogP | 2.94 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |