C21H18F3N3O4 — CID 129167101
(1S,11R,12R,13S)-5-hydroxy-13-methyl-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-4,7-diene-7-carboxamide (PubChem CID 129167101) has the molecular formula C21H18F3N3O4 and a molecular weight of 433.39 g/mol. Its IUPAC name is (1S,11R,12R,13S)-5-hydroxy-13-methyl-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | (1S,11R,12R,13S)-5-hydroxy-13-methyl-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 129167101 |
| Molecular Formula | C21H18F3N3O4 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (1S,11R,12R,13S)-5-hydroxy-13-methyl-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-4,7-diene-7-carboxamide |
| SMILES | C[C@H]1[C@H]2C[C@@H]1N1C(=O)c3c(O)c(=O)c(C(=O)NCc4c(F)cc(F)cc4F)cn3C[C@@H]21 |
| InChI | InChI=1S/C21H18F3N3O4/c1-8-10-4-15(8)27-16(10)7-26-6-12(18(28)19(29)17(26)21(27)31)20(30)25-5-11-13(23)2-9(22)3-14(11)24/h2-3,6,8,10,15-16,29H,4-5,7H2,1H3,(H,25,30)/t8-,10+,15-,16-/m0/s1 |
| InChIKey | KAORIVUJJWQJMR-WJOGWBRHSA-N |
| XLogP | 1.76 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |