C22H18F3N3O4 — CID 123142412
5-hydroxy-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide (PubChem CID 123142412) has the molecular formula C22H18F3N3O4 and a molecular weight of 445.40 g/mol. Its IUPAC name is 5-hydroxy-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide.
| Compound Name | 5-hydroxy-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 123142412 |
| Molecular Formula | C22H18F3N3O4 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 5-hydroxy-3,6-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N1C3CC(C4CC43)C1C2 |
| InChI | InChI=1S/C22H18F3N3O4/c23-8-1-14(24)12(15(25)2-8)5-26-21(31)13-6-27-7-17-11-4-16(10-3-9(10)11)28(17)22(32)18(27)20(30)19(13)29/h1-2,6,9-11,16-17,30H,3-5,7H2,(H,26,31) |
| InChIKey | IIRDVSLKIPYDNY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |