C22H20F3N3O4S — CID 148777481
(11S,16R)-7-hydroxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-17-thia-3,10-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-4,7-diene-5-carboxamide (PubChem CID 148777481) has the molecular formula C22H20F3N3O4S and a molecular weight of 479.48 g/mol. Its IUPAC name is (11S,16R)-7-hydroxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-17-thia-3,10-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-4,7-diene-5-carboxamide.
| Compound Name | (11S,16R)-7-hydroxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-17-thia-3,10-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-4,7-diene-5-carboxamide |
|---|---|
| PubChem CID | 148777481 |
| Molecular Formula | C22H20F3N3O4S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | (11S,16R)-7-hydroxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-17-thia-3,10-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-4,7-diene-5-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N1C(C2)S[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H20F3N3O4S/c23-10-5-13(24)11(14(25)6-10)7-26-21(31)12-8-27-9-17-28(15-3-1-2-4-16(15)33-17)22(32)18(27)20(30)19(12)29/h5-6,8,15-17,30H,1-4,7,9H2,(H,26,31)/t15-,16+,17?/m0/s1 |
| InChIKey | OJQMDBPBYBVPLR-RTKIROINSA-N |
| XLogP | 2.74 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |