C24H25F2N3O4S — CID 155306473
(6R)-6-cyclohexyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-thia-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 155306473) has the molecular formula C24H25F2N3O4S and a molecular weight of 489.54 g/mol. Its IUPAC name is (6R)-6-cyclohexyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-thia-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (6R)-6-cyclohexyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-thia-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 155306473 |
| Molecular Formula | C24H25F2N3O4S |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (6R)-6-cyclohexyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-thia-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N1C(C2)SC[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C24H25F2N3O4S/c25-15-7-6-14(17(26)8-15)9-27-23(32)16-10-28-11-19-29(24(33)20(28)22(31)21(16)30)18(12-34-19)13-4-2-1-3-5-13/h6-8,10,13,18-19,31H,1-5,9,11-12H2,(H,27,32)/t18-,19?/m0/s1 |
| InChIKey | TWBJFRMJZIGZCK-OYKVQYDMSA-N |
| XLogP | 3.24 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |