C22H21F2N3O5 — CID 90328406
(1S,11R,13S)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-14-methyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide (PubChem CID 90328406) has the molecular formula C22H21F2N3O5 and a molecular weight of 445.42 g/mol. Its IUPAC name is (1S,11R,13S)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-14-methyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide.
| Compound Name | (1S,11R,13S)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-14-methyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 90328406 |
| Molecular Formula | C22H21F2N3O5 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (1S,11R,13S)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-14-methyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide |
| SMILES | CC1C[C@H]2C[C@@H]1O[C@@H]1Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N21 |
| InChI | InChI=1S/C22H21F2N3O5/c1-10-4-13-6-16(10)32-17-9-26-8-14(19(28)20(29)18(26)22(31)27(13)17)21(30)25-7-11-2-3-12(23)5-15(11)24/h2-3,5,8,10,13,16-17,29H,4,6-7,9H2,1H3,(H,25,30)/t10?,13-,16-,17+/m0/s1 |
| InChIKey | DOTHVMMWDNQOGS-OTPYWFNVSA-N |
| XLogP | 1.74 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |