C18H15F2N3O5 — CID 66596574
(3S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 66596574) has the molecular formula C18H15F2N3O5 and a molecular weight of 391.33 g/mol. Its IUPAC name is (3S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (3S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 66596574 |
| Molecular Formula | C18H15F2N3O5 |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (3S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N1CCO[C@H]1C2 |
| InChI | InChI=1S/C18H15F2N3O5/c19-10-2-1-9(12(20)5-10)6-21-17(26)11-7-22-8-13-23(3-4-28-13)18(27)14(22)16(25)15(11)24/h1-2,5,7,13,25H,3-4,6,8H2,(H,21,26)/t13-/m0/s1 |
| InChIKey | WURLDGLAQTULNV-ZDUSSCGKSA-N |
| XLogP | 0.57 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |