C21H20F2N4O5 — CID 163840669
N-[13-[(2,4-difluorophenyl)methylcarbamoyl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]ethanimine oxide (PubChem CID 163840669) has the molecular formula C21H20F2N4O5 and a molecular weight of 446.41 g/mol. Its IUPAC name is N-[13-[(2,4-difluorophenyl)methylcarbamoyl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]ethanimine oxide.
| Compound Name | N-[13-[(2,4-difluorophenyl)methylcarbamoyl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]ethanimine oxide |
|---|---|
| PubChem CID | 163840669 |
| Molecular Formula | C21H20F2N4O5 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[13-[(2,4-difluorophenyl)methylcarbamoyl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]ethanimine oxide |
| SMILES | C/C=[N+](/[O-])c1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)CC1OCCCN1C2=O |
| InChI | InChI=1S/C21H20F2N4O5/c1-2-27(31)17-18-21(30)26-6-3-7-32-16(26)11-25(18)10-14(19(17)28)20(29)24-9-12-4-5-13(22)8-15(12)23/h2,4-5,8,10,16H,3,6-7,9,11H2,1H3,(H,24,29)/b27-2+ |
| InChIKey | OLRSLUVEXVCHGV-GNVABBSCSA-N |
| XLogP | 1.49 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|