C23H24F2N4O4 — CID 157446817
(10S,15S)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-15-methyl-2,5-dioxo-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide (PubChem CID 157446817) has the molecular formula C23H24F2N4O4 and a molecular weight of 458.47 g/mol. Its IUPAC name is (10S,15S)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-15-methyl-2,5-dioxo-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide.
| Compound Name | (10S,15S)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-15-methyl-2,5-dioxo-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 157446817 |
| Molecular Formula | C23H24F2N4O4 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (10S,15S)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-15-methyl-2,5-dioxo-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide |
| SMILES | C[C@@]12CCCN1[C@@H]1Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N1CC2 |
| InChI | InChI=1S/C23H24F2N4O4/c1-23-5-2-7-29(23)17-12-27-11-15(19(30)20(31)18(27)22(33)28(17)8-6-23)21(32)26-10-13-3-4-14(24)9-16(13)25/h3-4,9,11,17,31H,2,5-8,10,12H2,1H3,(H,26,32)/t17-,23+/m1/s1 |
| InChIKey | BSIAFPVFWDZXGF-HXOBKFHXSA-N |
| XLogP | 1.80 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |