C19H17F2N3O5 — CID 146357729
N-[(3,5-difluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 146357729) has the molecular formula C19H17F2N3O5 and a molecular weight of 405.36 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 146357729 |
| Molecular Formula | C19H17F2N3O5 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(F)c1)c1cn2c(c(O)c1=O)C(=O)N1CCCOC1C2 |
| InChI | InChI=1S/C19H17F2N3O5/c20-11-4-10(5-12(21)6-11)7-22-18(27)13-8-23-9-14-24(2-1-3-29-14)19(28)15(23)17(26)16(13)25/h4-6,8,14,26H,1-3,7,9H2,(H,22,27) |
| InChIKey | LVTDTPWGSTZINO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |