C22H19F2N3O5 — CID 130392525
(1R,13R)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-15-methylidene-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide (PubChem CID 130392525) has the molecular formula C22H19F2N3O5 and a molecular weight of 443.41 g/mol. Its IUPAC name is (1R,13R)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-15-methylidene-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide.
| Compound Name | (1R,13R)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-15-methylidene-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 130392525 |
| Molecular Formula | C22H19F2N3O5 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (1R,13R)-N-[(2,4-difluorophenyl)methyl]-5-hydroxy-15-methylidene-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide |
| SMILES | C=C1C[C@@H]2C[C@H]1N1C(=O)c3c(O)c(=O)c(C(=O)NCc4ccc(F)cc4F)cn3CC1O2 |
| InChI | InChI=1S/C22H19F2N3O5/c1-10-4-13-6-16(10)27-17(32-13)9-26-8-14(19(28)20(29)18(26)22(27)31)21(30)25-7-11-2-3-12(23)5-15(11)24/h2-3,5,8,13,16-17,29H,1,4,6-7,9H2,(H,25,30)/t13-,16-,17?/m1/s1 |
| InChIKey | WOAHESIREIKVEJ-ZIAVVELASA-N |
| XLogP | 1.66 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|