C21H19F2N3O4S — CID 155306477
(11S,14R)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-6,9-dioxo-16-thia-3,10-diazatetracyclo[8.6.0.03,8.011,14]hexadeca-4,7-diene-5-carboxamide (PubChem CID 155306477) has the molecular formula C21H19F2N3O4S and a molecular weight of 447.46 g/mol. Its IUPAC name is (11S,14R)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-6,9-dioxo-16-thia-3,10-diazatetracyclo[8.6.0.03,8.011,14]hexadeca-4,7-diene-5-carboxamide.
| Compound Name | (11S,14R)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-6,9-dioxo-16-thia-3,10-diazatetracyclo[8.6.0.03,8.011,14]hexadeca-4,7-diene-5-carboxamide |
|---|---|
| PubChem CID | 155306477 |
| Molecular Formula | C21H19F2N3O4S |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (11S,14R)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-6,9-dioxo-16-thia-3,10-diazatetracyclo[8.6.0.03,8.011,14]hexadeca-4,7-diene-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N1C(C2)SC[C@@H]2CC[C@@H]21 |
| InChI | InChI=1S/C21H19F2N3O4S/c22-12-3-1-10(14(23)5-12)6-24-20(29)13-7-25-8-16-26(15-4-2-11(15)9-31-16)21(30)17(25)19(28)18(13)27/h1,3,5,7,11,15-16,28H,2,4,6,8-9H2,(H,24,29)/t11-,15-,16?/m0/s1 |
| InChIKey | CEQNFNSHDGMJFA-QUJPKXGGSA-N |
| XLogP | 2.07 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |