C24H24F3N3O4 — CID 122496281
(10R,12S,14S)-15-ethyl-4-hydroxy-11-methyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatetracyclo[8.5.0.03,8.012,14]pentadeca-3,6-diene-6-carboxamide (PubChem CID 122496281) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is (10R,12S,14S)-15-ethyl-4-hydroxy-11-methyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatetracyclo[8.5.0.03,8.012,14]pentadeca-3,6-diene-6-carboxamide.
| Compound Name | (10R,12S,14S)-15-ethyl-4-hydroxy-11-methyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatetracyclo[8.5.0.03,8.012,14]pentadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 122496281 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (10R,12S,14S)-15-ethyl-4-hydroxy-11-methyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatetracyclo[8.5.0.03,8.012,14]pentadeca-3,6-diene-6-carboxamide |
| SMILES | CCC1[C@H]2C[C@H]2C(C)[C@@H]2Cn3cc(C(=O)NCc4c(F)cc(F)cc4F)c(=O)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C24H24F3N3O4/c1-3-18-13-6-12(13)10(2)19-9-29-8-15(21(31)22(32)20(29)24(34)30(18)19)23(33)28-7-14-16(26)4-11(25)5-17(14)27/h4-5,8,10,12-13,18-19,32H,3,6-7,9H2,1-2H3,(H,28,33)/t10?,12-,13-,18?,19-/m0/s1 |
| InChIKey | FHHDPQYLSCAAEQ-ZOIAUPCNSA-N |
| XLogP | 2.79 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |