C22H24F3N3O4 — CID 155155455
9-hydroxy-2-(4-methylpentan-2-yl)-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 155155455) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is 9-hydroxy-2-(4-methylpentan-2-yl)-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 9-hydroxy-2-(4-methylpentan-2-yl)-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 155155455 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 9-hydroxy-2-(4-methylpentan-2-yl)-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(C)CC(C)N1CCn2cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C22H24F3N3O4/c1-11(2)6-12(3)28-5-4-27-10-15(19(29)20(30)18(27)22(28)32)21(31)26-9-14-16(24)7-13(23)8-17(14)25/h7-8,10-12,30H,4-6,9H2,1-3H3,(H,26,31) |
| InChIKey | UVNUCKYIBLBBID-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |