C23H22F3N3O5 — CID 137448391
(9S)-4-hydroxy-9-(2-methoxyethyl)-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide (PubChem CID 137448391) has the molecular formula C23H22F3N3O5 and a molecular weight of 477.44 g/mol. Its IUPAC name is (9S)-4-hydroxy-9-(2-methoxyethyl)-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide.
| Compound Name | (9S)-4-hydroxy-9-(2-methoxyethyl)-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide |
|---|---|
| PubChem CID | 137448391 |
| Molecular Formula | C23H22F3N3O5 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (9S)-4-hydroxy-9-(2-methoxyethyl)-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide |
| SMILES | COCC[C@H]1C2CC=CCN2C(=O)c2c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn21 |
| InChI | InChI=1S/C23H22F3N3O5/c1-34-7-5-18-17-4-2-3-6-28(17)23(33)19-21(31)20(30)14(11-29(18)19)22(32)27-10-13-15(25)8-12(24)9-16(13)26/h2-3,8-9,11,17-18,31H,4-7,10H2,1H3,(H,27,32)/t17?,18-/m0/s1 |
| InChIKey | VQZNJFARYZZXEV-ZVAWYAOSSA-N |
| XLogP | 2.26 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|