C22H22F3N3O4 — CID 138599767
(3R,4S)-4-(cyclopropylmethyl)-9-hydroxy-2,3-dimethyl-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 138599767) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is (3R,4S)-4-(cyclopropylmethyl)-9-hydroxy-2,3-dimethyl-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3R,4S)-4-(cyclopropylmethyl)-9-hydroxy-2,3-dimethyl-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 138599767 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (3R,4S)-4-(cyclopropylmethyl)-9-hydroxy-2,3-dimethyl-1,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | C[C@@H]1[C@H](CC2CC2)n2cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(O)c2C(=O)N1C |
| InChI | InChI=1S/C22H22F3N3O4/c1-10-17(5-11-3-4-11)28-9-14(19(29)20(30)18(28)22(32)27(10)2)21(31)26-8-13-15(24)6-12(23)7-16(13)25/h6-7,9-11,17,30H,3-5,8H2,1-2H3,(H,26,31)/t10-,17+/m1/s1 |
| InChIKey | ZEVXPBDDGZSSHN-QGHHPUGFSA-N |
| XLogP | 2.72 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |